| Name |
Isohumulone B |
| Formula |
C21H20O5 |
| Mw |
352.13107375 |
| CAS RN |
1534-03-8 |
| C_ID |
C00050940
|
| InChIKey |
QARXXMMQVDCYGZ-FFPNMHRKNA-N |
| InChICode |
InChI=1S/C21H30O5/c1-12(2)7-9-15-19(24)18(16(22)11-14(5)6)20(25)21(15,26)17(23)10-8-13(3)4/h7-8,14-15,25-26H,9-11H2,1-6H3/t15-,21+/m1/s1 |
| SMILES |
CC(C)=CCC(=O)[C@]1(O)C(O)=C(C(=O)CC(C)C)C(=O)[C@H]1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
|
|
zoom in
| Organism | Humulus lupulus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|