| Name |
Isoguanine |
| Formula |
C5H5N5O |
| Mw |
151.04940982 |
| CAS RN |
3373-53-3 |
| C_ID |
C00050937
|
| InChIKey |
DRAVOWXCEBXPTN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-2)10-5(11)9-3/h1H,(H4,6,7,8,9,10,11) |
| SMILES |
Nc1nc(=O)[nH]c2nc[nH]c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
|
|
zoom in
| Organism | Croton tiglium |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
