| Name |
Isofraxidin 7-O-beta-D-glucoside Isofraxidin glucoside Isofraxidin beta-glucoside |
| Formula |
C17H20O10 |
| Mw |
384.10564686 |
| CAS RN |
483-91-0 |
| C_ID |
C00050932
|
| InChIKey |
IKUQEFGEUOOPGY-MAUBCAQWNA-N |
| InChICode |
InChI=1S/C17H20O10/c1-23-8-5-7-3-4-10(19)26-14(7)16(24-2)15(8)27-17-13(22)12(21)11(20)9(6-18)25-17/h3-5,9,11-13,17-18,20-22H,6H2,1-2H3/t9-,11-,12+,13-,17+/m1/s1 |
| SMILES |
COc1cc2ccc(=O)oc2c(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Acanthopanax senticosus  | Ref. |
| Plantae | Calycanthaceae | Calycanthus occidentalis | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
|
|
zoom in
| Organism | Acanthopanax senticosus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|