| Name |
Isofagaridine |
| Formula |
C20H16NO4 |
| Mw |
334.10793301 |
| CAS RN |
149998-48-1 |
| C_ID |
C00050929
|
| InChIKey |
RSCIYYHIBVZXDI-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C20H15NO4/c1-21-9-15-12(5-6-16(23-2)20(15)22)13-4-3-11-7-17-18(25-10-24-17)8-14(11)19(13)21/h3-9H,10H2,1-2H3/p+1 |
| SMILES |
COc1ccc2c(c[n+](C)c3c4cc5c(cc4ccc23)OCO5)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Zanthoxylum nitidum  | Ref. |
|
|
zoom in
| Organism | Zanthoxylum nitidum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wang, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 666 |
|---|
|