| Name |
Isodomoic acid D |
| Formula |
C15H21NO6 |
| Mw |
311.13688741 |
| CAS RN |
101977-26-8 |
| C_ID |
C00050914
|
| InChIKey |
VZFRNCSOCOPNDB-GCEAICGNNA-N |
| InChICode |
InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h3-5,9-11,13,16H,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b5-3-,8-4-/t9-,10+,11-,13+/m1/s1 |
| SMILES |
C/C(=C/C=C[C@@H](C)C(=O)O)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| - | - | Chondria armata | Ref. |
| - | - | Mytilus edulis  | Ref. |
|
|
zoom in
| Organism | Chondria armata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|