| Name |
Isodaucenol |
| Formula |
C15H24O |
| Mw |
220.18271539 |
| CAS RN |
147029-02-5 |
| C_ID |
C00050901
|
| InChIKey |
AUASPLXQOHHJLG-CKNGHHRPNA-N |
| InChICode |
InChI=1S/C15H24O/c1-11(2)13-7-9-15(3)8-6-12(10-16)4-5-14(13)15/h6,13-14,16H,1,4-5,7-10H2,2-3H3/t13-,14+,15+/m1/s1 |
| SMILES |
C=C(C)[C@H]1CC[C@]2(C)CC=C(CO)CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
|
|
zoom in
| Organism | Rosa rugosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|