| Name |
Isodaucenoic acid |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
138867-39-7 |
| C_ID |
C00050900
|
| InChIKey |
ZOELGNVFXIFAJQ-CKNGHHRPNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-10(2)12-7-9-15(3)8-6-11(14(16)17)4-5-13(12)15/h6,12-13H,1,4-5,7-9H2,2-3H3,(H,16,17)/t12-,13+,15+/m1/s1 |
| SMILES |
C=C(C)[C@H]1CC[C@]2(C)CC=C(OC=O)CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
|
|
zoom in
| Organism | Rosa rugosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|