| Name |
Isodaucene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
142878-08-8 |
| C_ID |
C00050899
|
| InChIKey |
RLNLRKHTQIXWHM-CKNGHHRPNA-N |
| InChICode |
InChI=1S/C15H24/c1-11(2)13-8-10-15(4)9-7-12(3)5-6-14(13)15/h7,13-14H,1,5-6,8-10H2,2-4H3/t13-,14+,15+/m1/s1 |
| SMILES |
C=C(C)[C@H]1CC[C@]2(C)CC=C(C)CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
|
|
zoom in
| Organism | Rosa rugosa |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
