| Name |
Isocryptotanshinone |
| Formula |
C19H20O3 |
| Mw |
296.1412445 |
| CAS RN |
22550-15-8 |
| C_ID |
C00050895
|
| InChIKey |
VUIHARLRBGHPEA-UEQNJFAPNA-N |
| InChICode |
InChI=1S/C19H20O3/c1-10-9-22-18-14(10)16(20)12-6-7-13-11(15(12)17(18)21)5-4-8-19(13,2)3/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m1/s1 |
| SMILES |
C[C@@H]1COC2=C1C(=O)c1ccc3c(c1C2=O)CCCC3(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
|
|
zoom in
| Organism | Salvia miltiorrhiza | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979) |
|---|
|