| Name |
Isocembrol Thunbergol |
| Formula |
C20H34O |
| Mw |
290.26096571 |
| CAS RN |
25269-17-4 |
| C_ID |
C00050885
|
| InChIKey |
YAPXSYXFLHDPCK-XIALOLFINA-N |
| InChICode |
|
| SMILES |
C/C1=C/CC[C@@](C)(O)/C=C/[C@H](C(C)C)CC/C(C)=C/CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Picea obovata | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|