| Name |
Isobauerenyl acetate |
| Formula |
C32H52O2 |
| Mw |
468.3967309 |
| CAS RN |
18541-62-3 |
| C_ID |
C00050876
|
| InChIKey |
GXGXUGKOSZFXNS-WQXJUBSANA-N |
| InChICode |
InChI=1S/C32H52O2/c1-20-12-15-29(6)18-19-31(8)24-10-11-25-28(4,5)26(34-22(3)33)14-16-30(25,7)23(24)13-17-32(31,9)27(29)21(20)2/h20-21,25-27H,10-19H2,1-9H3/t20-,21+,25+,26+,27-,29-,30-,31-,32+/m1/s1 |
| SMILES |
CC(=O)O[C@H]1CC[C@]2(C)C3=C(CC[C@H]2C1(C)C)[C@@]1(C)CC[C@@]2(C)CC[C@@H](C)[C@H](C)[C@H]2[C@]1(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
|
|
zoom in
| Organism | Forsythia suspensa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|