| Name |
Isobaimonidine |
| Formula |
C27H45NO3 |
| Mw |
431.33994431 |
| CAS RN |
74184-79-5 |
| C_ID |
C00050873
|
| InChIKey |
IUKLSMSEHKDIIP-ATLHLMKGNA-N |
| InChICode |
InChI=1S/C27H45NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-25,29-31H,4-14H2,1-3H3/t15-,16+,17+,18+,19-,20-,21-,22-,23+,24-,25-,26+,27-/m0/s1 |
| SMILES |
C[C@H]1CC[C@@H]2N(C1)C[C@H]1[C@@H]3C[C@H]4[C@@H](C[C@H](O)[C@H]5C[C@H](O)CC[C@@]54C)[C@@H]3CC[C@@H]1[C@]2(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Liliaceae | Fritillaria imperialis  | Ref. |
| Plantae | Liliaceae | Fritillaria verticillata var.thunbergii  | Ref. |
|
|
zoom in
| Organism | Fritillaria imperialis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ruan, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 14, (2002), 80 |
|---|
|