| Name |
Indigo Indigotin |
| Formula |
C16H10N2O2 |
| Mw |
262.07422758 |
| CAS RN |
482-89-3 |
| C_ID |
C00050824
|
| InChIKey |
COHYTHOBJLSHDF-YPKPFQOOSA-N |
| InChICode |
InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H |
| SMILES |
O=C1/C(=C2/Nc3ccccc3C2=O)Nc2ccccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Fabaceae | Indigofera tinctoria  | Ref. |
| Plantae | Polygonaceae | Polygonum tinctorium | Ref. |
|
|
zoom in
| Organism | Strobilanthes cusia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|