| Name |
Imidazolylpropionic acid |
| Formula |
C6H8N2O2 |
| Mw |
140.05857751 |
| CAS RN |
1074-59-5 |
| C_ID |
C00050820
|
| InChIKey |
GCVLTPPPFVYWBY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H8N2O2/c9-6(10)2-1-5-3-7-4-8-5/h3-4H,1-2H2,(H,7,8)(H,9,10) |
| SMILES |
O=COCCc1cnc[nH]1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Coprinaceae | Coprinus atramentarius  | Ref. |
|
|
zoom in
| Organism | Coprinus atramentarius |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
