| Name |
Icariside B6 |
| Formula |
C19H32O7 |
| Mw |
372.21480338 |
| CAS RN |
117596-83-5 |
| C_ID |
C00050807
|
| InChIKey |
BJFKUIUNGGPCAB-QOMMULQGNA-N |
| InChICode |
InChI=1S/C19H32O7/c1-10-7-12(8-19(3,4)13(10)6-5-11(2)21)25-18-17(24)16(23)15(22)14(9-20)26-18/h12,14-18,20,22-24H,5-9H2,1-4H3/t12-,14+,15+,16-,17+,18+/m0/s1 |
| SMILES |
CC(=O)CCC1=C(C)C[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
|
|
zoom in
| Organism | Epimedium sagittatum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|