| Name |
Icariol A1 |
| Formula |
C21H26O8 |
| Mw |
406.16276781 |
| CAS RN |
135743-06-5 |
| C_ID |
C00050805
|
| InChIKey |
OBLZEQONZQCOAS-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H26O8/c1-26-16-9-13(5-4-8-22)6-7-15(16)29-19(12-23)20(24)14-10-17(27-2)21(25)18(11-14)28-3/h6-7,9-11,19,22-23,25H,4-5,8,12H2,1-3H3 |
| SMILES |
COc1cc(CCCO)ccc1OC(CO)C(=O)c1cc(OC)c(O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
|
|
zoom in
| Organism | Epimedium sagittatum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
