| Name |
Hypecorine |
| Formula |
C20H19NO5 |
| Mw |
353.12632273 |
| CAS RN |
41787-56-8 |
| C_ID |
C00050796
|
| InChIKey |
JGUHXZNEJZIAFG-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H19NO5/c1-21-5-4-12-6-17-18(24-10-23-17)7-15(12)20(21)8-13-2-3-16-19(25-11-22-16)14(13)9-26-20/h2-3,6-7H,4-5,8-11H2,1H3 |
| SMILES |
CN1CCc2cc3c(cc2C12Cc1ccc4c(c1CO2)OCO4)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Hypecoum erectum | Ref. |
| Plantae | Fumariaceae | Hypecoum leptocarpum  | Ref. |
|
|
zoom in
| Organism | Hypecoum erectum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|