| Name |
9-Methoxycanthin-6-one 3-N-oxide |
| Formula |
C15H10N2O3 |
| Mw |
266.0691422 |
| CAS RN |
137739-74-3 |
| C_ID |
C00050768
|
| InChIKey |
IADUHWGVUSHTRQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10N2O3/c1-20-9-2-3-10-11-6-7-16(19)12-4-5-14(18)17(15(11)12)13(10)8-9/h2-8H,1H3 |
| SMILES |
COc1ccc2c3cc[n+]([O-])c4ccc(=O)n(c2c1)c34 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Simaroubaceae | Eurycoma longifolia  | Ref. |
|
|
zoom in
| Organism | Eurycoma longifolia |
|---|
| Reference | Guo, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 16, (2005), 88.
Kuo, et al., Journal of Natural Products, 66, (2003), 1324 |
|---|
|
