| Name |
4-Methoxysalicylaldehyde |
| Formula |
C8H6O3 |
| Mw |
150.03169406 |
| CAS RN |
673-22-3 |
| C_ID |
C00050720
|
| InChIKey |
WZUODJNEIXSNEU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O3/c1-11-7-3-2-6(5-9)8(10)4-7/h2-5,10H,1H3 |
| SMILES |
COc1ccc(C=O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Periploca sepium  | Ref. |
|
|
zoom in
| Organism | Periploca sepium |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
