| Name |
3-Isopropyl-6-tert-butyl-2,5-piperazinedione |
| Formula |
C11H20N2O2 |
| Mw |
212.1524779 |
| CAS RN |
79055-97-3 |
| C_ID |
C00050695
|
| InChIKey |
VURRRCSZDGSKAF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C11H20N2O2/c1-6(2)7-9(14)13-8(10(15)12-7)11(3,4)5/h6-8H,1-5H3,(H,12,15)(H,13,14) |
| SMILES |
CC(C)C1NC(=O)C(C(C)(C)C)NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Pinellia pedatisecta | Ref. |
|
|
zoom in
| Organism | Pinellia pedatisecta |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
