| Name |
1-Methoxycanthin-6-one |
| Formula |
C15H10N2O2 |
| Mw |
250.07422758 |
| CAS RN |
60755-86-4 |
| C_ID |
C00050646
|
| InChIKey |
LEPXKGXTXIACRO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10N2O2/c1-19-12-8-16-10-6-7-13(18)17-11-5-3-2-4-9(11)14(12)15(10)17/h2-8H,1H3 |
| SMILES |
COc1cnc2ccc(=O)n3c4ccccc4c1c23 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Simaroubaceae | Ailanthus altissima  | Ref. |
| Plantae | Simaroubaceae | Ailanthus excelsa  | Ref. |
|
|
zoom in
| Organism | Ailanthus altissima | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Hsieh, et al., Journal of Natural Products, 67, (2004), 1175 |
|---|
|