| Name |
15alpha-Hydroxytomatidenol |
| Formula |
C27H43NO3 |
| Mw |
429.32429425 |
| CAS RN |
7755-31-9 |
| C_ID |
C00050635
|
| InChIKey |
NDRFXTSOOBKFGG-RTTIAOFYNA-N |
| InChICode |
InChI=1S/C27H43NO3/c1-15-7-12-27(28-14-15)16(2)21-24(31-27)23(30)22-19-6-5-17-13-18(29)8-10-25(17,3)20(19)9-11-26(21,22)4/h5,15-16,18-24,28-30H,6-14H2,1-4H3/t15-,16-,18-,19+,20-,21-,22+,23+,24+,25-,26+,27-/m0/s1 |
| SMILES |
C[C@H]1CC[C@]2(NC1)O[C@H]1[C@H](O)[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Solanum dulcamara  | Ref. |
|
|
zoom in
| Organism | Solanum dulcamara | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|