| Name |
(+)-Leosibiricin |
| Formula |
C22H28O7 |
| Mw |
404.18350325 |
| CAS RN |
86575-85-1 |
| C_ID |
C00050611
|
| InChIKey |
PHOWZNFLUQUNMX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C22H28O7/c1-13(23)29-21(4)17(24)15-16-19(2,18(25)28-15)8-5-9-20(16,3)22(21,26)10-6-14-7-11-27-12-14/h7,11-12,15-16,26H,5-6,8-10H2,1-4H3 |
| SMILES |
CC(=O)OC1(C)C(=O)C2OC(=O)C3(C)CCCC(C)(C23)C1(O)CCc1ccoc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Leonurus sibiricus  | Ref. |
|
|
zoom in
| Organism | Leonurus sibiricus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|