| Name |
Ethoxychelerythrine |
| Formula |
C23H22NO5 |
| Mw |
392.14979782 |
| CAS RN |
79559-55-0 |
| C_ID |
C00050588
|
| InChIKey |
UJVQDDLAYPRWNM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H22NO5/c1-5-27-19-9-15-13-6-7-18(25-3)23(26-4)17(13)11-24(2)22(15)16-10-21-20(8-14(16)19)28-12-29-21/h6-11H,5,12H2,1-4H3/q+1 |
| SMILES |
CCOc1cc2c3ccc(OC)c(OC)c3c[n+](C)c2c2cc3c(cc12)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Macleaya cordata  | Ref. |
|
|
zoom in
| Organism | Macleaya cordata | | Reference | Tang, et al., Planta Med, 69, (2003), 97.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|