| Name |
Espeletone |
| Formula |
C14H18O3 |
| Mw |
234.12559444 |
| CAS RN |
51995-98-3 |
| C_ID |
C00050587
|
| InChIKey |
BVWCFOXBDSMXEP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H18O3/c1-9(2)7-13(16)12-8-11(10(3)15)5-6-14(12)17-4/h5-6,8-9H,7H2,1-4H3 |
| SMILES |
COc1ccc(C(C)=O)cc1C(=O)CC(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina pichinchensis var. bustamenta | Ref. |
| Plantae | Asteraceae | Eupatorium aschenbornianum  | Ref. |
|
|
zoom in
| Organism | Ageratina pichinchensis var. bustamenta |
|---|
| Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
