| Name |
Danshenxinkun C |
| Formula |
C16H12O3 |
| Mw |
252.07864425 |
| CAS RN |
65907-77-9 |
| C_ID |
C00050573
|
| InChIKey |
PYKVMQZMVZAUQN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O3/c1-8-4-3-5-11-10(8)6-7-12-13(11)16(19)15(18)9(2)14(12)17/h3-7,18H,1-2H3 |
| SMILES |
CC1=C(O)C(=O)c2c(ccc3c(C)cccc23)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
|
|
zoom in
| Organism | Salvia miltiorrhiza |
|---|
| Reference | Fang, et al., Huaxue Xuebao, 34, (1976), 197.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|
