| Name |
Danshenxinkun A |
| Formula |
C18H16O4 |
| Mw |
296.104859 |
| CAS RN |
65907-75-7 |
| C_ID |
C00050571
|
| InChIKey |
MHCXKYJBQMJPRJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O4/c1-9-4-3-5-12-11(9)6-7-13-15(12)18(22)17(21)14(16(13)20)10(2)8-19/h3-7,10,19,21H,8H2,1-2H3 |
| SMILES |
Cc1cccc2c3c(ccc12)C(=O)C(C(C)CO)=C(O)C3=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
|
|
zoom in
| Organism | Salvia miltiorrhiza |
|---|
| Reference | Fang, et al., Huaxue Xuebao, 34, (1976), 197.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|
