| Name |
Octacosyl ferulate Cluytyl ferulate |
| Formula |
C38H66O4 |
| Mw |
586.49611059 |
| CAS RN |
35321-71-2 |
| C_ID |
C00050561
|
| InChIKey |
PIGLOISSVVAGBD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C38H66O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-33-42-38(40)32-30-35-29-31-36(39)37(34-35)41-2/h29-32,34,39H,3-28,33H2,1-2H3 |
| SMILES |
CCCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)C=Cc1ccc(O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Lannea grandis | Ref. |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
|
|
zoom in
| Organism | Lannea grandis | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|