| Name |
Angustidine |
| Formula |
C19H15N3O |
| Mw |
301.12151212 |
| CAS RN |
40217-50-3 |
| C_ID |
C00050532
|
| InChIKey |
JCBVEVKMVDYNPQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H15N3O/c1-11-8-12-9-17-18-14(13-4-2-3-5-16(13)21-18)6-7-22(17)19(23)15(12)10-20-11/h2-5,8-10,21H,6-7H2,1H3 |
| SMILES |
Cc1cc2cc3n(c(=O)c2cn1)CCc1c-3[nH]c2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Uncaria rhynchophylla  | Ref. |
|
|
zoom in
| Organism | Uncaria rhynchophylla |
|---|
| Reference | Kang, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 762.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|
