| Name |
Agrimol G |
| Formula |
C36H44O12 |
| Mw |
668.28327687 |
| CAS RN |
121693-17-2 |
| C_ID |
C00050529
|
| InChIKey |
FBKJBTAHNUQRBX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C36H44O12/c1-13(2)25(37)22-31(43)20(11-18-28(40)16(7)35(47-9)23(33(18)45)26(38)14(3)4)30(42)21(32(22)44)12-19-29(41)17(8)36(48-10)24(34(19)46)27(39)15(5)6/h13-15,40-46H,11-12H2,1-10H3 |
| SMILES |
COc1c(C)c(O)c(Cc2c(O)c(Cc3c(O)c(C)c(OC)c(C(=O)C(C)C)c3O)c(O)c(C(=O)C(C)C)c2O)c(O)c1C(=O)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
|
|
zoom in
| Organism | Agrimonia pilosa var.japonica | | Reference | Yamaki, et al., Planta Med, 55, (1989), 169.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|