| Name |
Agrimol F |
| Formula |
C34H40O12 |
| Mw |
640.25197674 |
| CAS RN |
121693-16-1 |
| C_ID |
C00050528
|
| InChIKey |
CIVCQBPNDDPMAT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C34H40O12/c1-8-10-21(36)24-30(42)19(12-17-26(38)14(3)33(45-6)23(16(5)35)29(17)41)28(40)20(31(24)43)13-18-27(39)15(4)34(46-7)25(32(18)44)22(37)11-9-2/h38-44H,8-13H2,1-7H3 |
| SMILES |
CCCC(=O)c1c(O)c(Cc2c(O)c(C)c(OC)c(C(C)=O)c2O)c(O)c(Cc2c(O)c(C)c(OC)c(C(=O)CCC)c2O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
|
|
zoom in
| Organism | Agrimonia pilosa var.japonica | | Reference | Yamaki, et al., Planta Med, 55, (1989), 169.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|