| Name |
4,7-Dimethyl-1-tetralone |
| Formula |
C12H14O |
| Mw |
174.10446507 |
| CAS RN |
28449-86-7 |
| C_ID |
C00050519
|
| InChIKey |
SQESYXTWWGWCFK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H14O/c1-8-3-5-10-9(2)4-6-12(13)11(10)7-8/h3,5,7,9H,4,6H2,1-2H3 |
| SMILES |
Cc1ccc2c(c1)C(=O)CCC2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Cyperus rotundus  | Ref. |
|
|
zoom in
| Organism | Cyperus rotundus |
|---|
| Reference | Thebtaranonth, et al., Phytochemistry, 40, (1995), 125.
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001). |
|---|
|
