| Name |
Trifuhalol A octaacetate |
| Formula |
C34H30O18 |
| Mw |
726.14321416 |
| CAS RN |
51318-78-6 |
| C_ID |
C00049540
, 
|
| InChIKey |
FXVSSYLCUMZXFK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C34H30O18/c1-15(35)43-23-9-28(46-18(4)38)33(29(10-23)47-19(5)39)52-25-13-30(48-20(6)40)34(31(14-25)49-21(7)41)51-24-11-26(44-16(2)36)32(50-22(8)42)27(12-24)45-17(3)37/h9-14H,1-8H3 |
| SMILES |
CC(=O)Oc1cc(OC(C)=O)c(Oc2cc(OC(C)=O)c(Oc3cc(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c3)c(OC(C)=O)c2)c(OC(C)=O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Chromalveolata | Chordaceae | Chorda filum | Ref. |
| Chromalveolata | Sargassaceae | Carpophyllum angustifolium | Ref. |
| Chromalveolata | Sargassaceae | Halidrys siliquosa | Ref. |
|
|
zoom in
| Organism | Chorda filum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|