| Name |
(-)-Conduritol F Leucanthemitol |
| Formula |
C6H10O4 |
| Mw |
146.05790881 |
| CAS RN |
6090-98-8 |
| C_ID |
C00048929
, 
|
| InChIKey |
LRUBQXAKGXQBHA-KGULGNDLNA-N |
| InChICode |
InChI=1S/C6H10O4/c7-3-1-2-4(8)6(10)5(3)9/h1-10H/t3-,4+,5-,6-/m1/s1 |
| SMILES |
O[C@H]1[C@H](O)[C@@H](O)C=C[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Cynanchum bungei | Ref. |
| Plantae | Apocynaceae | Marsdenia tomentosa | Ref. |
|
|
zoom in
| Organism | Cynanchum bungei | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|