| Name |
Rubrosterone |
| Formula |
C19H26O5 |
| Mw |
334.17802394 |
| CAS RN |
19466-41-2 |
| C_ID |
C00048528
, 
|
| InChIKey |
OMQCWEJQYPUGJG-GOHCRIIANA-N |
| InChICode |
InChI=1S/C19H26O5/c1-17-9-15(22)14(21)8-12(17)13(20)7-11-10(17)3-5-18(2)16(23)4-6-19(11,18)24/h7,10,12,14-15,21-22,24H,3-6,8-9H2,1-2H3/t10-,12-,14+,15-,17+,18+,19+/m0/s1 |
| SMILES |
C[C@]12C[C@H](O)[C@H](O)C[C@H]1C(=O)C=C1[C@@H]2CC[C@]2(C)C(=O)CC[C@@]12O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes bidentata  | Ref. |
| Plantae | Amaranthaceae | Achyranthes rubrofusca | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
|
|
zoom in
| Organism | Achyranthes bidentata | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|