| Name |
7-epi-Isogarcinol 7-epiisogarcinol |
| Formula |
C38H50O6 |
| Mw |
602.36073933 |
| CAS RN |
1141378-40-6 |
| C_ID |
C00048299
, 
|
| InChIKey |
KXTNVBQRLRYVCO-ZJBPRGPWNA-N |
| InChICode |
InChI=1S/C38H50O6/c1-22(2)11-14-26-20-37-21-27(15-12-23(3)4)36(9,10)44-33(37)30(31(41)25-13-16-28(39)29(40)19-25)32(42)38(34(37)43,35(26,7)8)18-17-24(5)6/h11-13,16-17,19,26-27,39-40H,14-15,18,20-21H2,1-10H3/t26-,27-,37-,38-/m0/s1 |
| SMILES |
CC(C)=CC[C@H]1C[C@@]23C[C@H](CC=C(C)C)C(C)(C)[C@@](CC=C(C)C)(C(=O)C(C(=O)c4ccc(O)c(O)c4)=C2OC1(C)C)C3=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia epunctata  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Moronobea coccinea  | Ref. |
|
|
zoom in
| Organism | Garcinia epunctata | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|