| Name |
Alangilignoside C (+)-5,5'-Dimethoxy-9-O-beta-D-glucopyranosyl lariciresinol (+)-Alangilignoside C |
| Formula |
C28H38O13 |
| Mw |
582.2312413 |
| CAS RN |
191481-00-2 |
| C_ID |
C00047703
, 
|
| InChIKey |
HIFLTWHGASFARX-SSFLWZTINA-N |
| InChICode |
InChI=1S/C28H38O13/c1-35-17-6-13(7-18(36-2)22(17)30)5-15-11-39-27(14-8-19(37-3)23(31)20(9-14)38-4)16(15)12-40-28-26(34)25(33)24(32)21(10-29)41-28/h6-9,15-16,21,24-34H,5,10-12H2,1-4H3/t15-,16-,21+,24+,25-,26+,27+,28+/m0/s1 |
| SMILES |
COc1cc(C[C@H]2CO[C@H](c3cc(OC)c(O)c(OC)c3)[C@H]2CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| Plantae | Capparaceae | Capparis flavicans | Ref. |
| - | - | Baphicacanthus cusia  | Ref. |
|
|
zoom in
| Organism | Strobilanthes cusia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|