| Name |
Chrysalodin |
| Formula |
C30H20O9 |
| Mw |
524.11073224 |
| CAS RN |
114972-25-7 |
| C_ID |
C00045767
, 
|
| InChIKey |
DLKFSQPERBZZAT-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C30H20O9/c1-12-7-15-22(20(33)8-12)28(37)23-14(26(15)35)5-6-17(27(23)36)30(39)16-3-2-4-19(32)24(16)29(38)25-18(30)9-13(11-31)10-21(25)34/h2-10,31-34,36,39H,11H2,1H3/t30-/m1/s1 |
| SMILES |
Cc1cc(O)c2c(c1)C(=O)c1ccc(C3(O)c4cccc(O)c4C(=O)c4c(O)cc(CO)cc43)c(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe turkanensis | Ref. |
| Plantae | Asphodelaceae | Bulbine narcissifolia | Ref. |
|
|
zoom in
| Organism | Aloe megalacantha | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|