| Name |
Yohimbinic acid |
| Formula |
C20H24N2O3 |
| Mw |
340.17869265 |
| CAS RN |
522-87-2 |
| C_ID |
C00043120
, 
|
| InChIKey |
AADVZSXPNRLYLV-MDRUTUDONA-N |
| InChICode |
InChI=1S/C20H24N2O3/c23-17-6-5-11-10-22-8-7-13-12-3-1-2-4-15(12)21-19(13)16(22)9-14(11)18(17)20(24)25/h1-4,11,14,16-18,21,23H,5-10H2,(H,24,25)/t11-,14+,16-,17-,18+/m0/s1 |
| SMILES |
O=C(O)[C@@H]1[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3C[C@@H]2CC[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Rauwolfia sellowii | Ref. |
| Plantae | Apocynaceae | Rauwolfia serpentina | Ref. |
|
|
zoom in
| Organism | Rauwolfia sellowii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|