| Name |
Wallifoliol (-)-Wallifoliol |
| Formula |
C29H34O10 |
| Mw |
542.21519731 |
| CAS RN |
157232-60-5 |
| C_ID |
C00043117
, 
|
| InChIKey |
CIHPBJOPSVVYIO-YLPIVNKNNA-N |
| InChICode |
InChI=1S/C29H34O10/c1-14-17(31)12-27-20(14)29(35,24(34)39-25(27,3)4)26(5)18(32)11-19-28(13-36-19,38-15(2)30)21(26)22(27)37-23(33)16-9-7-6-8-10-16/h6-10,17-19,21-22,31-32,35H,11-13H2,1-5H3/t17-,18-,19+,21-,22-,26+,27-,28-,29+/m0/s1 |
| SMILES |
CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@]1(C)[C@@H]2[C@H](OC(=O)c2ccccc2)[C@]23C[C@H](O)C(C)=C2[C@@]1(O)C(=O)OC3(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Taxaceae | Taxus canadensis | Ref. |
| Plantae | Taxaceae | Taxus sumatrana  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
|
|
zoom in
| Organism | Taxus canadensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|