| Name |
Vescalagin |
| Formula |
C41H26O26 |
| Mw |
934.07123101 |
| CAS RN |
36001-47-5 |
| C_ID |
C00043104
, 
|
| InChIKey |
UDYKDZHZAKSYCO-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C41H26O26/c42-8-1-5-12(24(48)21(8)45)13-6(2-9(43)22(46)25(13)49)39(60)65-34-11(4-63-37(5)58)64-38(59)7-3-10(44)23(47)26(50)14(7)15-18-16(28(52)32(56)27(15)51)17-19-20(30(54)33(57)29(17)53)31(55)35(66-41(19)62)36(34)67-40(18)61/h1-3,11,31,34-36,42-57H,4H2/t11-,31+,34-,35-,36+/m0/s1 |
| SMILES |
O=C1OCC2OC(=O)c3cc(O)c(O)c(O)c3-c3c(O)c(O)c(O)c4c3C(=O)OC(C2OC(=O)c2cc(O)c(O)c(O)c2-c2c1cc(O)c(O)c2O)C1OC(=O)c2c-4c(O)c(O)c(O)c2C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fagaceae | Castanea mollissima  | Ref. |
| Plantae | Fagaceae | Castanea mollissima (leaf)  | Ref. |
| Plantae | Fagaceae | Castanea sativa Mill.  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
|
|
zoom in
| Organism | Castanea mollissima | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|