| Name |
Tenuifoliside C (-)-Tenuifoliside C |
| Formula |
C35H44O19 |
| Mw |
768.24767923 |
| CAS RN |
139726-37-7 |
| C_ID |
C00043065
, 
|
| InChIKey |
PMGMZCFZCYRJAG-BALUUTRHNA-N |
| InChICode |
InChI=1S/C35H44O19/c1-45-19-10-17(11-20(46-2)27(19)40)6-8-25(38)50-15-24-28(41)30(43)31(44)34(51-24)54-35(16-37)33(29(42)23(14-36)53-35)52-26(39)9-7-18-12-21(47-3)32(49-5)22(13-18)48-4/h6-13,23-24,28-31,33-34,36-37,40-44H,14-16H2,1-5H3/b8-6+,9-7+/t23-,24-,28-,29-,30+,31-,33+,34-,35+/m1/s1 |
| SMILES |
COc1cc(/C=C/C(=O)OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3OC(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)[C@H](O)[C@@H](O)[C@@H]2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygalaceae | Polygala amarella | Ref. |
| Plantae | Polygalaceae | Polygala glomerata  | Ref. |
| Plantae | Polygalaceae | Polygala tenuifolia  | Ref. |
| Plantae | Polygalaceae | Polygala tricornis | Ref. |
|
|
zoom in
| Organism | Polygala amarella | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yang, et al., CTHD, 33, (2002), 954 |
|---|
|