| Name |
Rhodomollein I |
| Formula |
C20H32O6 |
| Mw |
368.21988875 |
| CAS RN |
126223-68-5 |
| C_ID |
C00042912
, 
|
| InChIKey |
NXHMKIIWANFGSS-BDYWEMCENA-N |
| InChICode |
InChI=1S/C20H32O6/c1-9-10-5-6-11-15(23)19(10,8-18(11,4)25)7-12(21)20(26)13(9)14(22)16(24)17(20,2)3/h10-16,21-26H,1,5-8H2,2-4H3/t10-,11+,12+,13+,14-,15-,16-,18+,19-,20+/m0/s1 |
| SMILES |
C=C1[C@@H]2[C@H](O)[C@H](O)C(C)(C)[C@@]2(O)[C@H](O)C[C@]23C[C@@](C)(O)[C@H](CC[C@@H]12)C3O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Rhododendron molle(fruit) | Ref. |
| Plantae | Ericaceae | Rhododendron molle G.Don  | Ref. |
|
|
zoom in
| Organism | Rhododendron molle(fruit) | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|