| Name |
Rhodojaponin III |
| Formula |
C20H32O6 |
| Mw |
368.21988875 |
| CAS RN |
26342-66-5 |
| C_ID |
C00042910
, 
|
| InChIKey |
VUMZHZYKXUYIHM-XUXFOJAXNA-N |
| InChICode |
InChI=1S/C20H32O6/c1-16(2)15-12(26-15)13-18(4,24)10-6-5-9-14(22)19(10,8-17(9,3)23)7-11(21)20(13,16)25/h9-15,21-25H,5-8H2,1-4H3/t9-,10+,11-,12+,13+,14-,15+,17-,18-,19+,20-/m1/s1 |
| SMILES |
CC1(C)[C@H]2O[C@H]2[C@H]2[C@](C)(O)[C@@H]3CC[C@@H]4C(O)[C@@]3(C[C@@H](O)[C@@]21O)C[C@@]4(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Rhododendron japonicum | Ref. |
| Plantae | Ericaceae | Rhododendron molle(flower) | Ref. |
| Plantae | Ericaceae | Rhododendron molle(fruit) | Ref. |
| Plantae | Ericaceae | Rhododendron molle G.Don  | Ref. |
|
|
zoom in
| Organism | Rhododendron japonicum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chen, et al., JNP, 67, (2004), 1903.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985) |
|---|
|