| Name |
Ophioglonin |
| Formula |
C16H10O7 |
| Mw |
314.04265268 |
| CAS RN |
850894-18-7 |
| C_ID |
C00042806
, 
|
| InChIKey |
XUFSGVREMRKLBR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H10O7/c17-6-3-10(19)12-11(4-6)23-15-7-1-2-9(18)13(20)8(7)5-22-16(15)14(12)21/h1-4,17-20H,5H2 |
| SMILES |
O=c1c2c(oc3cc(O)cc(O)c13)-c1ccc(O)c(O)c1CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Ophioglossaceae | Ophioglossum petiolatum | Ref. |
|
|
zoom in
| Organism | Acacia catechu | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|