| Name |
Nb-Methylisoajmaline (+)-Nb-Methylisoajmaline |
| Formula |
C21H29N2O2 |
| Mw |
341.22290318 |
| CAS RN |
857297-89-3 |
| C_ID |
C00042762
, 
|
| InChIKey |
WDFQTBHCKDQVES-BAZHBZNWNA-N |
| InChICode |
InChI=1S/C21H29N2O2/c1-4-11-12-9-15-18-21(13-7-5-6-8-14(13)22(18)2)10-16(17(12)19(21)24)23(15,3)20(11)25/h5-8,11-12,15-20,24-25H,4,9-10H2,1-3H3/t11-,12+,15+,16+,17+,18+,19-,20+,21-/m1/s1 |
| SMILES |
[C@]123[C@H]([C@H]4[N@]5([C@@H](C1)[C@H]([C@@H](C4)[C@H]([C@@H]5O)CC)[C@H]3O)C)N(c1c2cccc1)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Rauwolfia sellowii | Ref. |
| Plantae | Apocynaceae | Rauwolfia serpentina | Ref. |
|
|
zoom in
| Organism | Rauwolfia sellowii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|