| Name |
Bisdemethoxycurcumin 1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione 1,9-Bis(4-hydroxyphenyl)-2,7-nonadiene-4,6-dione |
| Formula |
C19H16O4 |
| Mw |
308.104859 |
| CAS RN |
33171-05-0 |
| C_ID |
C00042286
, 
|
| InChIKey |
PREBVFJICNPEKM-YDWXAUTNSA-N |
| InChICode |
InChI=1S/C19H16O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-12,20-21H,13H2/b11-5+,12-6+ |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)CC(=O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Curcuma aromatica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|