| Name |
Aristophenone A |
| Formula |
C33H42O6 |
| Mw |
534.29813907 |
| CAS RN |
356055-29-3 |
| C_ID |
C00042241
, 
|
| InChIKey |
ZWAKZDYMQXZEGP-YOZHCBKYNA-N |
| InChICode |
InChI=1S/C33H42O6/c1-19(2)9-11-23-18-32(15-13-20(3)4)28(37)26(27(36)22-10-12-24(34)25(35)17-22)29(38)33(30(32)39,31(23,7)8)16-14-21(5)6/h9-10,12-14,17,23,34-35,37H,11,15-16,18H2,1-8H3/t23-,32+,33-/m1/s1 |
| SMILES |
CC(C)=CC[C@@H]1C[C@]2(CC=C(C)C)C(=O)[C@@](CC=C(C)C)(C(=O)C(C(=O)c3ccc(O)c(O)c3)=C2O)C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia aristata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus  | Ref. |
|
|
zoom in
| Organism | Garcinia aristata | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|