| Name |
Ananixanthone |
| Formula |
C23H22O5 |
| Mw |
378.14672381 |
| CAS RN |
216776-01-1 |
| C_ID |
C00042227
, 
|
| InChIKey |
WPZXDFBXPYQMFK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H22O5/c1-12(2)8-9-14-19(26)17-18(25)13-6-5-7-16(24)21(13)27-22(17)15-10-11-23(3,4)28-20(14)15/h5-8,10-11,24,26H,9H2,1-4H3 |
| SMILES |
CC(C)=CCc1c2c(c3oc4c(O)cccc4c(=O)c3c1O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia nigrolineata  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Symphonia globulifera | Ref. |
|
|
zoom in
| Organism | Garcinia nigrolineata |
|---|
| Reference | Rukachaisirikul, et al., Journal of Natural Products, 66, (2003), 1531.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11. |
|---|
|
