| Name |
Taxiphyllin |
| Formula |
C14H17NO7 |
| Mw |
311.10050191 |
| CAS RN |
21401-21-8 |
| C_ID |
C00041914
, 
|
| InChIKey |
NVLTYOJHPBMILU-KUEUEWHGNA-N |
| InChICode |
InChI=1S/C14H17NO7/c15-5-9(7-1-3-8(17)4-2-7)21-14-13(20)12(19)11(18)10(6-16)22-14/h1-4,9-14,16-20H,6H2/t9-,10+,11+,12-,13+,14+/m0/s1 |
| SMILES |
N#C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Calycanthaceae | Chimonanthus fragrans | Ref. |
| Plantae | Chenopodiaceae | Salsola tetrandra | Ref. |
| Plantae | Juncaginaceae | Triglochin maritimum  | Ref. |
| Plantae | Proteaceae | Macadamia ternifolia  | Ref. |
|
|
zoom in
| Organism | Chimonanthus fragrans | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|